C26H28FN5 — CID 44526345
1-[2-[[3-[4-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]ethyl]pyrrolidin-3-amine (PubChem CID 44526345) has the molecular formula C26H28FN5 and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-[2-[[3-[4-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]ethyl]pyrrolidin-3-amine.
| Compound Name | 1-[2-[[3-[4-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 44526345 |
| Molecular Formula | C26H28FN5 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-[2-[[3-[4-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methylamino]ethyl]pyrrolidin-3-amine |
| SMILES | NC1CCN(CCNCc2cccc(-c3ccc(-c4nc5ccc(F)cc5[nH]4)cc3)c2)C1 |
| InChI | InChI=1S/C26H28FN5/c27-22-8-9-24-25(15-22)31-26(30-24)20-6-4-19(5-7-20)21-3-1-2-18(14-21)16-29-11-13-32-12-10-23(28)17-32/h1-9,14-15,23,29H,10-13,16-17,28H2,(H,30,31) |
| InChIKey | RYIGIJLEJANSQB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|