C26H27FN4O — CID 44525119
2-[4-[[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol (PubChem CID 44525119) has the molecular formula C26H27FN4O and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[4-[[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 44525119 |
| Molecular Formula | C26H27FN4O |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[4-[[3-[3-(6-fluoro-1H-benzimidazol-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(Cc2cccc(-c3cccc(-c4nc5ccc(F)cc5[nH]4)c3)c2)CC1 |
| InChI | InChI=1S/C26H27FN4O/c27-23-7-8-24-25(17-23)29-26(28-24)22-6-2-5-21(16-22)20-4-1-3-19(15-20)18-31-11-9-30(10-12-31)13-14-32/h1-8,15-17,32H,9-14,18H2,(H,28,29) |
| InChIKey | KGSIRZKSSUNYLU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |