C26H20N6 — CID 4644404
3-[6-[2-(3-aminophenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]aniline (PubChem CID 4644404) has the molecular formula C26H20N6 and a molecular weight of 416.49 g/mol. Its IUPAC name is 3-[6-[2-(3-aminophenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]aniline.
| Compound Name | 3-[6-[2-(3-aminophenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]aniline |
|---|---|
| PubChem CID | 4644404 |
| Molecular Formula | C26H20N6 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[6-[2-(3-aminophenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]aniline |
| SMILES | Nc1cccc(-c2nc3ccc(-c4ccc5nc(-c6cccc(N)c6)[nH]c5c4)cc3[nH]2)c1 |
| InChI | InChI=1S/C26H20N6/c27-19-5-1-3-17(11-19)25-29-21-9-7-15(13-23(21)31-25)16-8-10-22-24(14-16)32-26(30-22)18-4-2-6-20(28)12-18/h1-14H,27-28H2,(H,29,31)(H,30,32) |
| InChIKey | QROWVLFOWUYBIG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|