C27H29F3N4O2 — CID 44524232
N'-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine;2,2,2-trifluoroacetic acid (PubChem CID 44524232) has the molecular formula C27H29F3N4O2 and a molecular weight of 498.55 g/mol. Its IUPAC name is N'-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | N'-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44524232 |
| Molecular Formula | C27H29F3N4O2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | N'-[[4-[3-(1H-benzimidazol-2-yl)phenyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCN(C)Cc1ccc(-c2cccc(-c3nc4ccccc4[nH]3)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N4.C2HF3O2/c1-28(2)15-16-29(3)18-19-11-13-20(14-12-19)21-7-6-8-22(17-21)25-26-23-9-4-5-10-24(23)27-25;3-2(4,5)1(6)7/h4-14,17H,15-16,18H2,1-3H3,(H,26,27);(H,6,7) |
| InChIKey | HSLUUIRNJLWXLG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |