C15H10Cl3N3O — CID 1348553
N-[4-(1H-benzimidazol-2-yl)phenyl]-2,2,2-trichloroacetamide (PubChem CID 1348553) has the molecular formula C15H10Cl3N3O and a molecular weight of 354.62 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 1348553 |
| Molecular Formula | C15H10Cl3N3O |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2,2,2-trichloroacetamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H10Cl3N3O/c16-15(17,18)14(22)19-10-7-5-9(6-8-10)13-20-11-3-1-2-4-12(11)21-13/h1-8H,(H,19,22)(H,20,21) |
| InChIKey | FTQWJPNJYVGEFZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|