C22H18N4OS — CID 2393320
1-(4-acetylphenyl)-3-[4-(1H-benzimidazol-2-yl)phenyl]thiourea (PubChem CID 2393320) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[4-(1H-benzimidazol-2-yl)phenyl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[4-(1H-benzimidazol-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 2393320 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[4-(1H-benzimidazol-2-yl)phenyl]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2ccc(-c3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C22H18N4OS/c1-14(27)15-6-10-17(11-7-15)23-22(28)24-18-12-8-16(9-13-18)21-25-19-4-2-3-5-20(19)26-21/h2-13H,1H3,(H,25,26)(H2,23,24,28) |
| InChIKey | NBDZAEGFHWKCPL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|