C20H14N4O3 — CID 3584641
N-[4-(1H-benzimidazol-2-yl)phenyl]-4-nitrobenzamide (PubChem CID 3584641) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-4-nitrobenzamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3584641 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3[nH]2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14N4O3/c25-20(14-7-11-16(12-8-14)24(26)27)21-15-9-5-13(6-10-15)19-22-17-3-1-2-4-18(17)23-19/h1-12H,(H,21,25)(H,22,23) |
| InChIKey | WMSCJGVAPPOKNO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|