C20H13N5O5 — CID 3113823
4-nitro-N-[4-(6-nitro-1H-benzimidazol-2-yl)phenyl]benzamide (PubChem CID 3113823) has the molecular formula C20H13N5O5 and a molecular weight of 403.35 g/mol. Its IUPAC name is 4-nitro-N-[4-(6-nitro-1H-benzimidazol-2-yl)phenyl]benzamide.
| Compound Name | 4-nitro-N-[4-(6-nitro-1H-benzimidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3113823 |
| Molecular Formula | C20H13N5O5 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 4-nitro-N-[4-(6-nitro-1H-benzimidazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccc([N+](=O)[O-])cc3[nH]2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H13N5O5/c26-20(13-3-7-15(8-4-13)24(27)28)21-14-5-1-12(2-6-14)19-22-17-10-9-16(25(29)30)11-18(17)23-19/h1-11H,(H,21,26)(H,22,23) |
| InChIKey | FLJBKWHBCXSBQJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|