C26H24N8O6 — CID 160698516
4-aminobenzoic acid;4-nitrobenzene-1,2-diamine;4-(6-nitro-1H-benzimidazol-2-yl)aniline (PubChem CID 160698516) has the molecular formula C26H24N8O6 and a molecular weight of 544.53 g/mol. Its IUPAC name is 4-aminobenzoic acid;4-nitrobenzene-1,2-diamine;4-(6-nitro-1H-benzimidazol-2-yl)aniline.
| Compound Name | 4-aminobenzoic acid;4-nitrobenzene-1,2-diamine;4-(6-nitro-1H-benzimidazol-2-yl)aniline |
|---|---|
| PubChem CID | 160698516 |
| Molecular Formula | C26H24N8O6 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 4-aminobenzoic acid;4-nitrobenzene-1,2-diamine;4-(6-nitro-1H-benzimidazol-2-yl)aniline |
| SMILES | Nc1ccc(-c2nc3ccc([N+](=O)[O-])cc3[nH]2)cc1.Nc1ccc(C(=O)O)cc1.Nc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C13H10N4O2.C7H7NO2.C6H7N3O2/c14-9-3-1-8(2-4-9)13-15-11-6-5-10(17(18)19)7-12(11)16-13;8-6-3-1-5(2-4-6)7(9)10;7-5-2-1-4(9(10)11)3-6(5)8/h1-7H,14H2,(H,15,16);1-4H,8H2,(H,9,10);1-3H,7-8H2 |
| InChIKey | RQHOLUBQVJUVRL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 256.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|