C46H36N10O8 — CID 159007170
4-(3,4-diaminophenyl)benzene-1,2-diamine;4-nitrobenzoic acid;2-(4-nitrophenyl)-6-[2-(4-nitrophenyl)-3H-indol-6-yl]-1H-benzimidazole (PubChem CID 159007170) has the molecular formula C46H36N10O8 and a molecular weight of 856.86 g/mol. Its IUPAC name is 4-(3,4-diaminophenyl)benzene-1,2-diamine;4-nitrobenzoic acid;2-(4-nitrophenyl)-6-[2-(4-nitrophenyl)-3H-indol-6-yl]-1H-benzimidazole.
| Compound Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;4-nitrobenzoic acid;2-(4-nitrophenyl)-6-[2-(4-nitrophenyl)-3H-indol-6-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 159007170 |
| Molecular Formula | C46H36N10O8 |
| Molecular Weight | 856.86 g/mol |
| Exact Mass | 856.27 |
| IUPAC Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;4-nitrobenzoic acid;2-(4-nitrophenyl)-6-[2-(4-nitrophenyl)-3H-indol-6-yl]-1H-benzimidazole |
| SMILES | Nc1ccc(-c2ccc(N)c(N)c2)cc1N.O=C(O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(C2=Nc3cc(-c4ccc5nc(-c6ccc([N+](=O)[O-])cc6)[nH]c5c4)ccc3C2)cc1 |
| InChI | InChI=1S/C27H17N5O4.C12H14N4.C7H5NO4/c33-31(34)21-8-3-16(4-9-21)24-15-20-2-1-18(13-25(20)28-24)19-7-12-23-26(14-19)30-27(29-23)17-5-10-22(11-6-17)32(35)36;13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;9-7(10)5-1-3-6(4-2-5)8(11)12/h1-14H,15H2,(H,29,30);1-6H,13-16H2;1-4H,(H,9,10) |
| InChIKey | JSBKBMBRCDHCAJ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 311.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.86 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|