C49H36N10O — CID 158070006
4-(3,4-diaminophenyl)benzene-1,2-diamine;4-isocyanobenzaldehyde;4-[6-[2-(4-isocyanophenyl)-3H-benzimidazol-5-yl]-3H-indol-2-yl]benzonitrile (PubChem CID 158070006) has the molecular formula C49H36N10O and a molecular weight of 780.90 g/mol. Its IUPAC name is 4-(3,4-diaminophenyl)benzene-1,2-diamine;4-isocyanobenzaldehyde;4-[6-[2-(4-isocyanophenyl)-3H-benzimidazol-5-yl]-3H-indol-2-yl]benzonitrile.
| Compound Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;4-isocyanobenzaldehyde;4-[6-[2-(4-isocyanophenyl)-3H-benzimidazol-5-yl]-3H-indol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 158070006 |
| Molecular Formula | C49H36N10O |
| Molecular Weight | 780.90 g/mol |
| Exact Mass | 780.31 |
| IUPAC Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine;4-isocyanobenzaldehyde;4-[6-[2-(4-isocyanophenyl)-3H-benzimidazol-5-yl]-3H-indol-2-yl]benzonitrile |
| SMILES | Nc1ccc(-c2ccc(N)c(N)c2)cc1N.[C-]#[N+]c1ccc(-c2nc3ccc(-c4ccc5c(c4)N=C(c4ccc(C#N)cc4)C5)cc3[nH]2)cc1.[C-]#[N+]c1ccc(C=O)cc1 |
| InChI | InChI=1S/C29H17N5.C12H14N4.C8H5NO/c1-31-24-11-8-20(9-12-24)29-33-25-13-10-22(15-28(25)34-29)21-6-7-23-16-26(32-27(23)14-21)19-4-2-18(17-30)3-5-19;13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;1-9-8-4-2-7(6-10)3-5-8/h2-15H,16H2,(H,33,34);1-6H,13-16H2;2-6H |
| InChIKey | FLSCYIIKWRMRAQ-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 194.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.90 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|