C48H32N8O2 — CID 159051114
2-[4-(5-carbamoyl-3H-indol-2-yl)phenyl]-3H-indole-5-carboxamide;2-[4-(5-isocyano-3H-indol-2-yl)phenyl]-3H-indole-5-carbonitrile (PubChem CID 159051114) has the molecular formula C48H32N8O2 and a molecular weight of 752.84 g/mol. Its IUPAC name is 2-[4-(5-carbamoyl-3H-indol-2-yl)phenyl]-3H-indole-5-carboxamide;2-[4-(5-isocyano-3H-indol-2-yl)phenyl]-3H-indole-5-carbonitrile.
| Compound Name | 2-[4-(5-carbamoyl-3H-indol-2-yl)phenyl]-3H-indole-5-carboxamide;2-[4-(5-isocyano-3H-indol-2-yl)phenyl]-3H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 159051114 |
| Molecular Formula | C48H32N8O2 |
| Molecular Weight | 752.84 g/mol |
| Exact Mass | 752.26 |
| IUPAC Name | 2-[4-(5-carbamoyl-3H-indol-2-yl)phenyl]-3H-indole-5-carboxamide;2-[4-(5-isocyano-3H-indol-2-yl)phenyl]-3H-indole-5-carbonitrile |
| SMILES | NC(=O)c1ccc2c(c1)CC(c1ccc(C3=Nc4ccc(C(N)=O)cc4C3)cc1)=N2.[C-]#[N+]c1ccc2c(c1)CC(c1ccc(C3=Nc4ccc(C#N)cc4C3)cc1)=N2 |
| InChI | InChI=1S/C24H18N4O2.C24H14N4/c25-23(29)15-5-7-19-17(9-15)11-21(27-19)13-1-2-14(4-3-13)22-12-18-10-16(24(26)30)6-8-20(18)28-22;1-26-20-7-9-22-19(11-20)13-24(28-22)17-5-3-16(4-6-17)23-12-18-10-15(14-25)2-8-21(18)27-23/h1-10H,11-12H2,(H2,25,29)(H2,26,30);2-11H,12-13H2 |
| InChIKey | JXGWWHDUMVIGBC-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 163.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.84 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|