C33H38N6O2 — CID 157495605
2-[4-[5-[2-(dimethylamino)ethylcarbamoyl]-3H-indol-2-yl]phenyl]-N-[3-(dimethylamino)propyl]-3H-indole-5-carboxamide (PubChem CID 157495605) has the molecular formula C33H38N6O2 and a molecular weight of 550.71 g/mol. Its IUPAC name is 2-[4-[5-[2-(dimethylamino)ethylcarbamoyl]-3H-indol-2-yl]phenyl]-N-[3-(dimethylamino)propyl]-3H-indole-5-carboxamide.
| Compound Name | 2-[4-[5-[2-(dimethylamino)ethylcarbamoyl]-3H-indol-2-yl]phenyl]-N-[3-(dimethylamino)propyl]-3H-indole-5-carboxamide |
|---|---|
| PubChem CID | 157495605 |
| Molecular Formula | C33H38N6O2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 2-[4-[5-[2-(dimethylamino)ethylcarbamoyl]-3H-indol-2-yl]phenyl]-N-[3-(dimethylamino)propyl]-3H-indole-5-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc2c(c1)CC(c1ccc(C3=Nc4ccc(C(=O)NCCN(C)C)cc4C3)cc1)=N2 |
| InChI | InChI=1S/C33H38N6O2/c1-38(2)16-5-14-34-32(40)24-10-12-28-26(18-24)20-30(36-28)22-6-8-23(9-7-22)31-21-27-19-25(11-13-29(27)37-31)33(41)35-15-17-39(3)4/h6-13,18-19H,5,14-17,20-21H2,1-4H3,(H,34,40)(H,35,41) |
| InChIKey | ADPRZUTWFIXOAQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|