C28H10N6 — CID 160880778
(5Z,11E)-5,11-bis[cyano(isocyano)methylidene]-3-isocyano-6,12-dihydroindeno[1,2-b]fluorene-9-carbonitrile (PubChem CID 160880778) has the molecular formula C28H10N6 and a molecular weight of 430.43 g/mol. Its IUPAC name is (5Z,11E)-5,11-bis[cyano(isocyano)methylidene]-3-isocyano-6,12-dihydroindeno[1,2-b]fluorene-9-carbonitrile.
| Compound Name | (5Z,11E)-5,11-bis[cyano(isocyano)methylidene]-3-isocyano-6,12-dihydroindeno[1,2-b]fluorene-9-carbonitrile |
|---|---|
| PubChem CID | 160880778 |
| Molecular Formula | C28H10N6 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (5Z,11E)-5,11-bis[cyano(isocyano)methylidene]-3-isocyano-6,12-dihydroindeno[1,2-b]fluorene-9-carbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=c1/c2c(/c(=C(\C#N)[N+]#[C-])c3c1-c1cc([N+]#[C-])ccc1C3)-c1cc(C#N)ccc1C2 |
| InChI | InChI=1S/C28H10N6/c1-32-18-7-6-17-10-22-26(20(17)11-18)28(24(14-31)34-3)21-9-16-5-4-15(12-29)8-19(16)25(21)27(22)23(13-30)33-2/h4-8,11H,9-10H2/b27-23+,28-24- |
| InChIKey | SMZQMRBVJHFCFS-YFMKTMAWSA-N |
| XLogP | 4.35 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|