C10H10N2 — CID 91199216
ethane;3-isocyanobenzonitrile (PubChem CID 91199216) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is ethane;3-isocyanobenzonitrile.
| Compound Name | ethane;3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 91199216 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | ethane;3-isocyanobenzonitrile |
| SMILES | CC.[C-]#[N+]c1cccc(C#N)c1 |
| InChI | InChI=1S/C8H4N2.C2H6/c1-10-8-4-2-3-7(5-8)6-9;1-2/h2-5H;1-2H3 |
| InChIKey | PSIIURGSZOEPSG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|