C24H14N4O4 — CID 167351152
3-[2,5-diacetyl-1-(3-isocyanophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzonitrile (PubChem CID 167351152) has the molecular formula C24H14N4O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is 3-[2,5-diacetyl-1-(3-isocyanophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzonitrile.
| Compound Name | 3-[2,5-diacetyl-1-(3-isocyanophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 167351152 |
| Molecular Formula | C24H14N4O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-[2,5-diacetyl-1-(3-isocyanophenyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(C2=C3C(=O)N(C(C)=O)C(c4cccc(C#N)c4)=C3C(=O)N2C(C)=O)c1 |
| InChI | InChI=1S/C24H14N4O4/c1-13(29)27-21(16-7-4-6-15(10-16)12-25)19-20(24(27)32)22(28(14(2)30)23(19)31)17-8-5-9-18(11-17)26-3/h4-11H,1-2H3 |
| InChIKey | VCPRXNXLYGXUTM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|