C34H19N5 — CID 169061564
4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]benzene-1,2-dicarbonitrile (PubChem CID 169061564) has the molecular formula C34H19N5 and a molecular weight of 497.56 g/mol. Its IUPAC name is 4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169061564 |
| Molecular Formula | C34H19N5 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(N(c3ccc(-c4cccc(C#N)c4)cc3)c3ccc(C#N)c(C#N)c3)cc2)c1 |
| InChI | InChI=1S/C34H19N5/c1-38-31-7-3-6-28(19-31)26-10-15-33(16-11-26)39(34-17-12-29(22-36)30(20-34)23-37)32-13-8-25(9-14-32)27-5-2-4-24(18-27)21-35/h2-20H |
| InChIKey | BKDIMLYRIZIGQX-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|