C36H17N7 — CID 169061473
5-[4-[N,4-bis(3-cyano-5-isocyanophenyl)anilino]phenyl]benzene-1,3-dicarbonitrile (PubChem CID 169061473) has the molecular formula C36H17N7 and a molecular weight of 547.58 g/mol. Its IUPAC name is 5-[4-[N,4-bis(3-cyano-5-isocyanophenyl)anilino]phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-[N,4-bis(3-cyano-5-isocyanophenyl)anilino]phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 169061473 |
| Molecular Formula | C36H17N7 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 5-[4-[N,4-bis(3-cyano-5-isocyanophenyl)anilino]phenyl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc(N(c3ccc(-c4cc(C#N)cc(C#N)c4)cc3)c3cc(C#N)cc([N+]#[C-])c3)cc2)c1 |
| InChI | InChI=1S/C36H17N7/c1-41-32-15-26(22-39)14-31(18-32)29-5-9-35(10-6-29)43(36-17-27(23-40)16-33(19-36)42-2)34-7-3-28(4-8-34)30-12-24(20-37)11-25(13-30)21-38/h3-19H |
| InChIKey | OWUXPMBYXFGHRE-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 107.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|