C34H17N5O — CID 169061326
3-(4-dibenzofuran-4-yl-N-(3,4-diisocyanophenyl)anilino)-5-isocyanobenzonitrile (PubChem CID 169061326) has the molecular formula C34H17N5O and a molecular weight of 511.54 g/mol. Its IUPAC name is 3-(4-dibenzofuran-4-yl-N-(3,4-diisocyanophenyl)anilino)-5-isocyanobenzonitrile.
| Compound Name | 3-(4-dibenzofuran-4-yl-N-(3,4-diisocyanophenyl)anilino)-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 169061326 |
| Molecular Formula | C34H17N5O |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 3-(4-dibenzofuran-4-yl-N-(3,4-diisocyanophenyl)anilino)-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(N(c2ccc(-c3cccc4c3oc3ccccc34)cc2)c2ccc([N+]#[C-])c([N+]#[C-])c2)c1 |
| InChI | InChI=1S/C34H17N5O/c1-36-24-17-22(21-35)18-27(19-24)39(26-15-16-31(37-2)32(20-26)38-3)25-13-11-23(12-14-25)28-8-6-9-30-29-7-4-5-10-33(29)40-34(28)30/h4-20H |
| InChIKey | GFJFCMZBPHKCDX-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 53.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|