C36H17N7 — CID 169061480
4-[4-[N-(3-cyano-5-isocyanophenyl)-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile (PubChem CID 169061480) has the molecular formula C36H17N7 and a molecular weight of 547.58 g/mol. Its IUPAC name is 4-[4-[N-(3-cyano-5-isocyanophenyl)-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[N-(3-cyano-5-isocyanophenyl)-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169061480 |
| Molecular Formula | C36H17N7 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 4-[4-[N-(3-cyano-5-isocyanophenyl)-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(N(c2ccc(-c3ccc(C#N)c(C#N)c3)cc2)c2ccc(-c3ccc([N+]#[C-])c([N+]#[C-])c3)cc2)c1 |
| InChI | InChI=1S/C36H17N7/c1-40-31-16-24(21-37)17-34(20-31)43(32-11-6-25(7-12-32)27-4-5-29(22-38)30(18-27)23-39)33-13-8-26(9-14-33)28-10-15-35(41-2)36(19-28)42-3/h4-20H |
| InChIKey | UDCXCBKDAYXSMZ-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 87.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|