C40H23N5S — CID 169061499
3-[4-[N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(4-cyanophenyl)anilino]phenyl]-5-isocyanobenzonitrile (PubChem CID 169061499) has the molecular formula C40H23N5S and a molecular weight of 605.73 g/mol. Its IUPAC name is 3-[4-[N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(4-cyanophenyl)anilino]phenyl]-5-isocyanobenzonitrile.
| Compound Name | 3-[4-[N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(4-cyanophenyl)anilino]phenyl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 169061499 |
| Molecular Formula | C40H23N5S |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | 3-[4-[N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(4-cyanophenyl)anilino]phenyl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc(N(c3ccc(-c4ccc(C#N)cc4)cc3)c3ccc(-c4nc5ccccc5s4)cc3)cc2)c1 |
| InChI | InChI=1S/C40H23N5S/c1-43-34-23-28(26-42)22-33(24-34)31-12-18-36(19-13-31)45(35-16-10-30(11-17-35)29-8-6-27(25-41)7-9-29)37-20-14-32(15-21-37)40-44-38-4-2-3-5-39(38)46-40/h2-24H |
| InChIKey | ANROSAXJUYQCNB-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 68.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|