C53H31N5S2 — CID 171736392
4-[[7-[4-(1,3-benzothiazol-2-yl)-N-(4-isocyanophenyl)anilino]phenanthren-2-yl]-dibenzothiophen-2-ylamino]benzonitrile (PubChem CID 171736392) has the molecular formula C53H31N5S2 and a molecular weight of 802.00 g/mol. Its IUPAC name is 4-[[7-[4-(1,3-benzothiazol-2-yl)-N-(4-isocyanophenyl)anilino]phenanthren-2-yl]-dibenzothiophen-2-ylamino]benzonitrile.
| Compound Name | 4-[[7-[4-(1,3-benzothiazol-2-yl)-N-(4-isocyanophenyl)anilino]phenanthren-2-yl]-dibenzothiophen-2-ylamino]benzonitrile |
|---|---|
| PubChem CID | 171736392 |
| Molecular Formula | C53H31N5S2 |
| Molecular Weight | 802.00 g/mol |
| Exact Mass | 801.20 |
| IUPAC Name | 4-[[7-[4-(1,3-benzothiazol-2-yl)-N-(4-isocyanophenyl)anilino]phenanthren-2-yl]-dibenzothiophen-2-ylamino]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(-c3nc4ccccc4s3)cc2)c2ccc3c(ccc4cc(N(c5ccc(C#N)cc5)c5ccc6sc7ccccc7c6c5)ccc43)c2)cc1 |
| InChI | InChI=1S/C53H31N5S2/c1-55-38-16-22-41(23-17-38)57(40-20-14-35(15-21-40)53-56-49-7-3-5-9-52(49)60-53)42-24-27-45-36(30-42)12-13-37-31-43(25-28-46(37)45)58(39-18-10-34(33-54)11-19-39)44-26-29-51-48(32-44)47-6-2-4-8-50(47)59-51/h2-32H |
| InChIKey | ITMAKMYYCXEJNX-UHFFFAOYSA-N |
| XLogP | 16.00 |
| TPSA | 47.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.00 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|