C52H28N6S2 — CID 155655744
4-[dibenzothiophen-3-yl-[13-(N-dibenzothiophen-3-yl-4-isocyanoanilino)-2,10-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaen-6-yl]amino]benzonitrile (PubChem CID 155655744) has the molecular formula C52H28N6S2 and a molecular weight of 800.97 g/mol. Its IUPAC name is 4-[dibenzothiophen-3-yl-[13-(N-dibenzothiophen-3-yl-4-isocyanoanilino)-2,10-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaen-6-yl]amino]benzonitrile.
| Compound Name | 4-[dibenzothiophen-3-yl-[13-(N-dibenzothiophen-3-yl-4-isocyanoanilino)-2,10-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaen-6-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 155655744 |
| Molecular Formula | C52H28N6S2 |
| Molecular Weight | 800.97 g/mol |
| Exact Mass | 800.18 |
| IUPAC Name | 4-[dibenzothiophen-3-yl-[13-(N-dibenzothiophen-3-yl-4-isocyanoanilino)-2,10-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,5,7,9,11,13,15-octaen-6-yl]amino]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2cc3ncc4cc(N(c5ccc(C#N)cc5)c5ccc6c(c5)sc5ccccc56)cc5cnc(c2)c3c45)c2ccc3c(c2)sc2ccccc23)cc1 |
| InChI | InChI=1S/C52H28N6S2/c1-54-34-12-16-36(17-13-34)58(38-19-21-44-42-7-3-5-9-48(42)60-50(44)27-38)40-24-45-52-46(25-40)56-30-33-23-39(22-32(29-55-45)51(33)52)57(35-14-10-31(28-53)11-15-35)37-18-20-43-41-6-2-4-8-47(41)59-49(43)26-37/h2-27,29-30H |
| InChIKey | QAIVDVNVBVZVJB-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 60.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.97 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|