C40H24N6 — CID 155600058
4-(4-cyano-N-[13-(N-phenylanilino)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-6-yl]anilino)benzonitrile (PubChem CID 155600058) has the molecular formula C40H24N6 and a molecular weight of 588.67 g/mol. Its IUPAC name is 4-(4-cyano-N-[13-(N-phenylanilino)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-6-yl]anilino)benzonitrile.
| Compound Name | 4-(4-cyano-N-[13-(N-phenylanilino)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-6-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 155600058 |
| Molecular Formula | C40H24N6 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 4-(4-cyano-N-[13-(N-phenylanilino)-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaen-6-yl]anilino)benzonitrile |
| SMILES | N#Cc1ccc(N(c2ccc(C#N)cc2)c2cc3cnc4cc(N(c5ccccc5)c5ccccc5)cc5cnc(c2)c3c54)cc1 |
| InChI | InChI=1S/C40H24N6/c41-23-27-11-15-33(16-12-27)46(34-17-13-28(24-42)14-18-34)36-20-30-26-43-37-21-35(19-29-25-44-38(22-36)40(30)39(29)37)45(31-7-3-1-4-8-31)32-9-5-2-6-10-32/h1-22,25-26H |
| InChIKey | YNDWPTUMTXBVCS-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|