C51H33N5 — CID 122466280
4-[14-[3,5-bis(N-phenylanilino)phenyl]-11,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl]benzonitrile (PubChem CID 122466280) has the molecular formula C51H33N5 and a molecular weight of 715.86 g/mol. Its IUPAC name is 4-[14-[3,5-bis(N-phenylanilino)phenyl]-11,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl]benzonitrile.
| Compound Name | 4-[14-[3,5-bis(N-phenylanilino)phenyl]-11,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl]benzonitrile |
|---|---|
| PubChem CID | 122466280 |
| Molecular Formula | C51H33N5 |
| Molecular Weight | 715.86 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 4-[14-[3,5-bis(N-phenylanilino)phenyl]-11,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-12-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(-c3cc(N(c4ccccc4)c4ccccc4)cc(N(c4ccccc4)c4ccccc4)c3)c3c(n2)-c2cccc4cccc-3c24)cc1 |
| InChI | InChI=1S/C51H33N5/c52-34-35-27-29-37(30-28-35)51-53-49(48-45-25-13-15-36-16-14-26-46(47(36)45)50(48)54-51)38-31-43(55(39-17-5-1-6-18-39)40-19-7-2-8-20-40)33-44(32-38)56(41-21-9-3-10-22-41)42-23-11-4-12-24-42/h1-33H |
| InChIKey | PYXMRPDKKPXNAM-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.86 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |