C42H28N6 — CID 140915776
3,6-bis[4-(N-phenylanilino)phenyl]pyrazine-2,5-dicarbonitrile (PubChem CID 140915776) has the molecular formula C42H28N6 and a molecular weight of 616.73 g/mol. Its IUPAC name is 3,6-bis[4-(N-phenylanilino)phenyl]pyrazine-2,5-dicarbonitrile.
| Compound Name | 3,6-bis[4-(N-phenylanilino)phenyl]pyrazine-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 140915776 |
| Molecular Formula | C42H28N6 |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 3,6-bis[4-(N-phenylanilino)phenyl]pyrazine-2,5-dicarbonitrile |
| SMILES | N#Cc1nc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C#N)nc1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H28N6/c43-29-39-41(31-21-25-37(26-22-31)47(33-13-5-1-6-14-33)34-15-7-2-8-16-34)45-40(30-44)42(46-39)32-23-27-38(28-24-32)48(35-17-9-3-10-18-35)36-19-11-4-12-20-36/h1-28H |
| InChIKey | WLNKPUXAOGKLNP-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |