C46H30N6 — CID 156781139
2,3-bis[4-(N-phenylanilino)phenyl]quinoxaline-6,7-dicarbonitrile (PubChem CID 156781139) has the molecular formula C46H30N6 and a molecular weight of 666.79 g/mol. Its IUPAC name is 2,3-bis[4-(N-phenylanilino)phenyl]quinoxaline-6,7-dicarbonitrile.
| Compound Name | 2,3-bis[4-(N-phenylanilino)phenyl]quinoxaline-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 156781139 |
| Molecular Formula | C46H30N6 |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | 2,3-bis[4-(N-phenylanilino)phenyl]quinoxaline-6,7-dicarbonitrile |
| SMILES | N#Cc1cc2nc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)nc2cc1C#N |
| InChI | InChI=1S/C46H30N6/c47-31-35-29-43-44(30-36(35)32-48)50-46(34-23-27-42(28-24-34)52(39-17-9-3-10-18-39)40-19-11-4-12-20-40)45(49-43)33-21-25-41(26-22-33)51(37-13-5-1-6-14-37)38-15-7-2-8-16-38/h1-30H |
| InChIKey | FIYUTPLIPPTWEN-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 79.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |