C42H27N5 — CID 146221726
3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenanthro[9,10-b]quinoxaline-11,12-dicarbonitrile (PubChem CID 146221726) has the molecular formula C42H27N5 and a molecular weight of 601.71 g/mol. Its IUPAC name is 3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenanthro[9,10-b]quinoxaline-11,12-dicarbonitrile.
| Compound Name | 3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenanthro[9,10-b]quinoxaline-11,12-dicarbonitrile |
|---|---|
| PubChem CID | 146221726 |
| Molecular Formula | C42H27N5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 3-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenanthro[9,10-b]quinoxaline-11,12-dicarbonitrile |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc4c(c3)c3ccccc3c3nc5cc(C#N)c(C#N)cc5nc43)cc2)cc1 |
| InChI | InChI=1S/C42H27N5/c1-26-7-14-32(15-8-26)47(33-16-9-27(2)10-17-33)34-18-11-28(12-19-34)29-13-20-37-38(21-29)35-5-3-4-6-36(35)41-42(37)46-40-23-31(25-44)30(24-43)22-39(40)45-41/h3-23H,1-2H3 |
| InChIKey | LYNYATISSISNFA-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 76.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|