C60H34N8 — CID 170655596
3,6-diisocyano-11,12-bis[4-(N-phenylanilino)phenyl]phenanthro[9,10-b]quinoxaline-2,7-dicarbonitrile (PubChem CID 170655596) has the molecular formula C60H34N8 and a molecular weight of 866.99 g/mol. Its IUPAC name is 3,6-diisocyano-11,12-bis[4-(N-phenylanilino)phenyl]phenanthro[9,10-b]quinoxaline-2,7-dicarbonitrile.
| Compound Name | 3,6-diisocyano-11,12-bis[4-(N-phenylanilino)phenyl]phenanthro[9,10-b]quinoxaline-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 170655596 |
| Molecular Formula | C60H34N8 |
| Molecular Weight | 866.99 g/mol |
| Exact Mass | 866.29 |
| IUPAC Name | 3,6-diisocyano-11,12-bis[4-(N-phenylanilino)phenyl]phenanthro[9,10-b]quinoxaline-2,7-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc2c3cc([N+]#[C-])c(C#N)cc3c3nc4cc(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)cc4nc3c2cc1C#N |
| InChI | InChI=1S/C60H34N8/c1-63-55-35-51-52-36-56(64-2)42(38-62)32-54(52)60-59(53(51)31-41(55)37-61)65-57-33-49(39-23-27-47(28-24-39)67(43-15-7-3-8-16-43)44-17-9-4-10-18-44)50(34-58(57)66-60)40-25-29-48(30-26-40)68(45-19-11-5-12-20-45)46-21-13-6-14-22-46/h3-36H |
| InChIKey | YKRBWFJQRMQPIL-UHFFFAOYSA-N |
| XLogP | 16.21 |
| TPSA | 88.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.99 |
| LogP ≤ 5 | 16.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|