C62H37N9 — CID 140779678
2-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-5-[3,6-bis(N-phenylanilino)carbazol-9-yl]-4-isocyanobenzonitrile (PubChem CID 140779678) has the molecular formula C62H37N9 and a molecular weight of 908.04 g/mol. Its IUPAC name is 2-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-5-[3,6-bis(N-phenylanilino)carbazol-9-yl]-4-isocyanobenzonitrile.
| Compound Name | 2-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-5-[3,6-bis(N-phenylanilino)carbazol-9-yl]-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140779678 |
| Molecular Formula | C62H37N9 |
| Molecular Weight | 908.04 g/mol |
| Exact Mass | 907.32 |
| IUPAC Name | 2-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-5-[3,6-bis(N-phenylanilino)carbazol-9-yl]-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cc(-c3ccc(C#N)cc3)nc(-c3ccc(C#N)cc3)n2)c(C#N)cc1-n1c2ccc(N(c3ccccc3)c3ccccc3)cc2c2cc(N(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C62H37N9/c1-66-58-37-53(57-38-56(44-26-22-42(39-63)23-27-44)67-62(68-57)45-28-24-43(40-64)25-29-45)46(41-65)34-61(58)71-59-32-30-51(69(47-14-6-2-7-15-47)48-16-8-3-9-17-48)35-54(59)55-36-52(31-33-60(55)71)70(49-18-10-4-11-19-49)50-20-12-5-13-21-50/h2-38H |
| InChIKey | PLBQTISUAZFWEL-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 112.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.04 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|