C61H38N8 — CID 126734678
2-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)benzonitrile (PubChem CID 126734678) has the molecular formula C61H38N8 and a molecular weight of 883.03 g/mol. Its IUPAC name is 2-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)benzonitrile.
| Compound Name | 2-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 126734678 |
| Molecular Formula | C61H38N8 |
| Molecular Weight | 883.03 g/mol |
| Exact Mass | 882.32 |
| IUPAC Name | 2-[3,6-bis(N-(4-cyanophenyl)anilino)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)benzonitrile |
| SMILES | N#Cc1ccc(N(c2ccccc2)c2ccc3c(c2)c2cc(N(c4ccccc4)c4ccc(C#N)cc4)ccc2n3-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2C#N)cc1 |
| InChI | InChI=1S/C61H38N8/c62-39-42-21-26-50(27-22-42)67(48-17-9-3-10-18-48)52-30-33-59-54(36-52)55-37-53(68(49-19-11-4-12-20-49)51-28-23-43(40-63)24-29-51)31-34-60(55)69(59)58-32-25-46(35-47(58)41-64)57-38-56(44-13-5-1-6-14-44)65-61(66-57)45-15-7-2-8-16-45/h1-38H |
| InChIKey | UYOVYQPLHFKMAL-UHFFFAOYSA-N |
| XLogP | 15.13 |
| TPSA | 108.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.03 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |