C55H33N7 — CID 126734829
5-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-2-[4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]benzonitrile (PubChem CID 126734829) has the molecular formula C55H33N7 and a molecular weight of 791.92 g/mol. Its IUPAC name is 5-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-2-[4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]benzonitrile.
| Compound Name | 5-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-2-[4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 126734829 |
| Molecular Formula | C55H33N7 |
| Molecular Weight | 791.92 g/mol |
| Exact Mass | 791.28 |
| IUPAC Name | 5-[2,6-bis(4-cyanophenyl)pyrimidin-4-yl]-2-[4-[3-(N-phenylanilino)carbazol-9-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc(-c4ccc(-n5c6ccccc6c6cc(N(c7ccccc7)c7ccccc7)ccc65)cc4)c(C#N)c3)nc(-c3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C55H33N7/c56-34-37-15-19-40(20-16-37)51-33-52(60-55(59-51)41-21-17-38(35-57)18-22-41)42-25-29-48(43(31-42)36-58)39-23-26-46(27-24-39)62-53-14-8-7-13-49(53)50-32-47(28-30-54(50)62)61(44-9-3-1-4-10-44)45-11-5-2-6-12-45/h1-33H |
| InChIKey | DVPXCADISUZVBS-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 105.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.92 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |