C67H42N8 — CID 140779396
5-[3-(N-(4-cyanophenyl)anilino)-6-(N-(4-isocyanophenyl)anilino)carbazol-9-yl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile (PubChem CID 140779396) has the molecular formula C67H42N8 and a molecular weight of 959.13 g/mol. Its IUPAC name is 5-[3-(N-(4-cyanophenyl)anilino)-6-(N-(4-isocyanophenyl)anilino)carbazol-9-yl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile.
| Compound Name | 5-[3-(N-(4-cyanophenyl)anilino)-6-(N-(4-isocyanophenyl)anilino)carbazol-9-yl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 140779396 |
| Molecular Formula | C67H42N8 |
| Molecular Weight | 959.13 g/mol |
| Exact Mass | 958.35 |
| IUPAC Name | 5-[3-(N-(4-cyanophenyl)anilino)-6-(N-(4-isocyanophenyl)anilino)carbazol-9-yl]-2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccccc2)c2ccc3c(c2)c2cc(N(c4ccccc4)c4ccc(C#N)cc4)ccc2n3-c2ccc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c(C#N)c2)cc1 |
| InChI | InChI=1S/C67H42N8/c1-70-52-28-32-56(33-29-52)74(54-20-12-5-13-21-54)59-36-39-66-62(42-59)61-41-58(73(53-18-10-4-11-19-53)55-30-22-46(44-68)23-31-55)35-38-65(61)75(66)57-34-37-60(51(40-57)45-69)47-24-26-49(27-25-47)64-43-63(48-14-6-2-7-15-48)71-67(72-64)50-16-8-3-9-17-50/h2-43H |
| InChIKey | RQBGDUMOHDLMLR-UHFFFAOYSA-N |
| XLogP | 17.48 |
| TPSA | 89.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.13 |
| LogP ≤ 5 | 17.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|