C61H37N7 — CID 140779542
2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5-[4-[3-(4-isocyano-N-(4-isocyanophenyl)anilino)carbazol-9-yl]phenyl]benzonitrile (PubChem CID 140779542) has the molecular formula C61H37N7 and a molecular weight of 868.02 g/mol. Its IUPAC name is 2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5-[4-[3-(4-isocyano-N-(4-isocyanophenyl)anilino)carbazol-9-yl]phenyl]benzonitrile.
| Compound Name | 2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5-[4-[3-(4-isocyano-N-(4-isocyanophenyl)anilino)carbazol-9-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 140779542 |
| Molecular Formula | C61H37N7 |
| Molecular Weight | 868.02 g/mol |
| Exact Mass | 867.31 |
| IUPAC Name | 2-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-5-[4-[3-(4-isocyano-N-(4-isocyanophenyl)anilino)carbazol-9-yl]phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc([N+]#[C-])cc2)c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3ccc(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c(C#N)c3)cc2)cc1 |
| InChI | InChI=1S/C61H37N7/c1-63-48-24-30-50(31-25-48)67(51-32-26-49(64-2)27-33-51)53-34-36-60-56(38-53)55-15-9-10-16-59(55)68(60)52-28-21-41(22-29-52)46-23-35-54(47(37-46)40-62)42-17-19-44(20-18-42)58-39-57(43-11-5-3-6-12-43)65-61(66-58)45-13-7-4-8-14-45/h3-39H |
| InChIKey | VEHNLNXHJXAAFJ-UHFFFAOYSA-N |
| XLogP | 16.35 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.02 |
| LogP ≤ 5 | 16.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|