C78H47N7 — CID 158449552
2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile (PubChem CID 158449552) has the molecular formula C78H47N7 and a molecular weight of 1082.28 g/mol. Its IUPAC name is 2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile.
| Compound Name | 2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 158449552 |
| Molecular Formula | C78H47N7 |
| Molecular Weight | 1082.28 g/mol |
| Exact Mass | 1081.39 |
| IUPAC Name | 2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazol-3-yl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ccc(-n3c4ccccc4c4ccccc43)cc2)c(C#N)c1 |
| InChI | InChI=1S/C78H47N7/c1-80-57-37-42-60(56(44-57)49-79)54-36-43-76-68(45-54)65-26-12-17-31-75(65)85(76)77-66(50-32-38-58(39-33-50)83-71-27-13-8-22-61(71)62-23-9-14-28-72(62)83)46-55(70-48-69(52-18-4-2-5-19-52)81-78(82-70)53-20-6-3-7-21-53)47-67(77)51-34-40-59(41-35-51)84-73-29-15-10-24-63(73)64-25-11-16-30-74(64)84/h2-48H |
| InChIKey | VJHKEJNXCKMFMJ-UHFFFAOYSA-N |
| XLogP | 20.19 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.28 |
| LogP ≤ 5 | 20.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|