C83H50N8 — CID 161320065
2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-isocyanophenyl)carbazol-3-yl]benzonitrile (PubChem CID 161320065) has the molecular formula C83H50N8 and a molecular weight of 1159.37 g/mol. Its IUPAC name is 2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-isocyanophenyl)carbazol-3-yl]benzonitrile.
| Compound Name | 2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-isocyanophenyl)carbazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 161320065 |
| Molecular Formula | C83H50N8 |
| Molecular Weight | 1159.37 g/mol |
| Exact Mass | 1158.42 |
| IUPAC Name | 2-[9-[2,6-bis(4-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-isocyanophenyl)carbazol-3-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc2c(c1)c1cc(-c3ccccc3C#N)ccc1n2-c1c(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C83H50N8/c1-85-73-31-15-10-26-64(73)58-41-47-79-72(49-58)71-48-57(63-25-9-8-24-59(63)52-84)40-46-78(71)91(79)80-69(53-36-42-61(43-37-53)89-74-32-16-11-27-65(74)66-28-12-17-33-75(66)89)50-60(83-87-81(55-20-4-2-5-21-55)86-82(88-83)56-22-6-3-7-23-56)51-70(80)54-38-44-62(45-39-54)90-76-34-18-13-29-67(76)68-30-14-19-35-77(68)90/h2-51H |
| InChIKey | PRPWKTQMDNFPEZ-UHFFFAOYSA-N |
| XLogP | 21.25 |
| TPSA | 81.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.37 |
| LogP ≤ 5 | 21.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|