C54H31N7 — CID 155447205
2-[9-[2,6-bis(3-cyanophenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile (PubChem CID 155447205) has the molecular formula C54H31N7 and a molecular weight of 777.89 g/mol. Its IUPAC name is 2-[9-[2,6-bis(3-cyanophenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile.
| Compound Name | 2-[9-[2,6-bis(3-cyanophenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 155447205 |
| Molecular Formula | C54H31N7 |
| Molecular Weight | 777.89 g/mol |
| Exact Mass | 777.26 |
| IUPAC Name | 2-[9-[2,6-bis(3-cyanophenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cccc(C#N)c3)c2-n2c3ccccc3c3cc(-c4ccccc4C#N)ccc32)c1 |
| InChI | InChI=1S/C54H31N7/c55-32-35-13-11-20-39(27-35)46-30-43(54-59-52(37-15-3-1-4-16-37)58-53(60-54)38-17-5-2-6-18-38)31-47(40-21-12-14-36(28-40)33-56)51(46)61-49-24-10-9-23-45(49)48-29-41(25-26-50(48)61)44-22-8-7-19-42(44)34-57/h1-31H |
| InChIKey | POUGSSDXHAXAQY-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 114.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.89 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |