C53H32N6 — CID 155656799
3-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]benzonitrile (PubChem CID 155656799) has the molecular formula C53H32N6 and a molecular weight of 752.88 g/mol. Its IUPAC name is 3-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]benzonitrile.
| Compound Name | 3-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155656799 |
| Molecular Formula | C53H32N6 |
| Molecular Weight | 752.88 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 3-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)-2-(3-phenylcarbazol-9-yl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cccc(C#N)c3)c2-n2c3ccccc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C53H32N6/c1-55-43-24-14-23-41(30-43)46-33-42(53-57-51(37-18-7-3-8-19-37)56-52(58-53)38-20-9-4-10-21-38)32-45(40-22-13-15-35(29-40)34-54)50(46)59-48-26-12-11-25-44(48)47-31-39(27-28-49(47)59)36-16-5-2-6-17-36/h2-33H |
| InChIKey | SMCLXDOPNXNAJD-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.88 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|