C59H36N6 — CID 155656523
3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile (PubChem CID 155656523) has the molecular formula C59H36N6 and a molecular weight of 828.98 g/mol. Its IUPAC name is 3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile.
| Compound Name | 3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155656523 |
| Molecular Formula | C59H36N6 |
| Molecular Weight | 828.98 g/mol |
| Exact Mass | 828.30 |
| IUPAC Name | 3-[2-(3,6-diphenylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cccc(C#N)c3)c2-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C59H36N6/c1-61-49-27-15-26-47(33-49)51-37-48(59-63-57(42-21-10-4-11-22-42)62-58(64-59)43-23-12-5-13-24-43)36-50(46-25-14-16-39(32-46)38-60)56(51)65-54-30-28-44(40-17-6-2-7-18-40)34-52(54)53-35-45(29-31-55(53)65)41-19-8-3-9-20-41/h2-37H |
| InChIKey | NFIRDWUAMGMMPR-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.98 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|