C62H35N7 — CID 155656677
2-[3-(2-cyanophenyl)-2-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile (PubChem CID 155656677) has the molecular formula C62H35N7 and a molecular weight of 878.01 g/mol. Its IUPAC name is 2-[3-(2-cyanophenyl)-2-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile.
| Compound Name | 2-[3-(2-cyanophenyl)-2-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155656677 |
| Molecular Formula | C62H35N7 |
| Molecular Weight | 878.01 g/mol |
| Exact Mass | 877.30 |
| IUPAC Name | 2-[3-(2-cyanophenyl)-2-[3-(3-cyanophenyl)-6-(3-isocyanophenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)c2cc(-c4cccc(C#N)c4)ccc2n3-c2c(-c3ccccc3C#N)cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ccccc2C#N)c1 |
| InChI | InChI=1S/C62H35N7/c1-66-50-23-13-22-44(31-50)46-27-29-60-54(33-46)53-32-45(43-21-12-14-40(30-43)37-63)26-28-59(53)69(60)61-55(51-24-10-8-19-47(51)38-64)34-49(35-56(61)52-25-11-9-20-48(52)39-65)58-36-57(41-15-4-2-5-16-41)67-62(68-58)42-17-6-3-7-18-42/h2-36H |
| InChIKey | FENSLHGSBCJCKJ-UHFFFAOYSA-N |
| XLogP | 15.41 |
| TPSA | 106.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.01 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|