C64H33N9 — CID 155656495
3-[9-[2,6-bis(2-cyanophenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile (PubChem CID 155656495) has the molecular formula C64H33N9 and a molecular weight of 928.03 g/mol. Its IUPAC name is 3-[9-[2,6-bis(2-cyanophenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile.
| Compound Name | 3-[9-[2,6-bis(2-cyanophenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 155656495 |
| Molecular Formula | C64H33N9 |
| Molecular Weight | 928.03 g/mol |
| Exact Mass | 927.29 |
| IUPAC Name | 3-[9-[2,6-bis(2-cyanophenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(3-cyano-5-isocyanophenyl)carbazol-3-yl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc3c(c2)c2cc(-c4cc(C#N)cc([N+]#[C-])c4)ccc2n3-c2c(-c3ccccc3C#N)cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc2-c2ccccc2C#N)c1 |
| InChI | InChI=1S/C64H33N9/c1-69-51-27-40(36-65)25-48(29-51)44-21-23-61-55(31-44)56-32-45(49-26-41(37-66)28-52(30-49)70-2)22-24-62(56)73(61)63-57(53-19-11-9-17-46(53)38-67)33-50(34-58(63)54-20-12-10-18-47(54)39-68)64-71-59(42-13-5-3-6-14-42)35-60(72-64)43-15-7-4-8-16-43/h3-35H |
| InChIKey | BJUIKHWBFPOUKH-UHFFFAOYSA-N |
| XLogP | 15.83 |
| TPSA | 134.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.03 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|