C78H47N11 — CID 155447170
2-[2-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(2-cyanophenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile (PubChem CID 155447170) has the molecular formula C78H47N11 and a molecular weight of 1138.31 g/mol. Its IUPAC name is 2-[2-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(2-cyanophenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile.
| Compound Name | 2-[2-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(2-cyanophenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155447170 |
| Molecular Formula | C78H47N11 |
| Molecular Weight | 1138.31 g/mol |
| Exact Mass | 1137.40 |
| IUPAC Name | 2-[2-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(2-cyanophenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-c2ccccc2C#N)c1-n1c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C78H47N11/c79-48-58-35-19-21-37-61(58)65-45-60(68-47-67(50-23-7-1-8-24-50)81-72(82-68)51-25-9-2-10-26-51)46-66(62-38-22-20-36-59(62)49-80)71(65)89-69-41-39-56(77-85-73(52-27-11-3-12-28-52)83-74(86-77)53-29-13-4-14-30-53)43-63(69)64-44-57(40-42-70(64)89)78-87-75(54-31-15-5-16-32-54)84-76(88-78)55-33-17-6-18-34-55/h1-47H |
| InChIKey | UZRKKCKRMVGFRG-UHFFFAOYSA-N |
| XLogP | 18.02 |
| TPSA | 155.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.31 |
| LogP ≤ 5 | 18.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |