C78H47F6N9 — CID 155447054
9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 155447054) has the molecular formula C78H47F6N9 and a molecular weight of 1224.29 g/mol. Its IUPAC name is 9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 155447054 |
| Molecular Formula | C78H47F6N9 |
| Molecular Weight | 1224.29 g/mol |
| Exact Mass | 1223.39 |
| IUPAC Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | FC(F)(F)c1ccccc1-c1cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-c2ccccc2C(F)(F)F)c1-n1c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C78H47F6N9/c79-77(80,81)63-37-21-19-35-57(63)61-45-56(66-47-65(48-23-7-1-8-24-48)85-70(86-66)49-25-9-2-10-26-49)46-62(58-36-20-22-38-64(58)78(82,83)84)69(61)93-67-41-39-54(75-89-71(50-27-11-3-12-28-50)87-72(90-75)51-29-13-4-14-30-51)43-59(67)60-44-55(40-42-68(60)93)76-91-73(52-31-15-5-16-32-52)88-74(92-76)53-33-17-6-18-34-53/h1-47H |
| InChIKey | DYJYUGUPWBJHIT-UHFFFAOYSA-N |
| XLogP | 20.32 |
| TPSA | 108.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1224.29 |
| LogP ≤ 5 | 20.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |