C62H37F6N7 — CID 155447546
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazole (PubChem CID 155447546) has the molecular formula C62H37F6N7 and a molecular weight of 994.02 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazole.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 155447546 |
| Molecular Formula | C62H37F6N7 |
| Molecular Weight | 994.02 g/mol |
| Exact Mass | 993.30 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazole |
| SMILES | FC(F)(F)c1ccccc1-c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-c2ccccc2C(F)(F)F)c1-n1c2ccccc2c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C62H37F6N7/c63-61(64,65)50-30-16-13-27-44(50)48-36-43(60-73-57(40-23-9-3-10-24-40)70-58(74-60)41-25-11-4-12-26-41)37-49(45-28-14-17-31-51(45)62(66,67)68)54(48)75-52-32-18-15-29-46(52)47-35-42(33-34-53(47)75)59-71-55(38-19-5-1-6-20-38)69-56(72-59)39-21-7-2-8-22-39/h1-37H |
| InChIKey | SSNCXXQWCPQTQE-UHFFFAOYSA-N |
| XLogP | 16.53 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.02 |
| LogP ≤ 5 | 16.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |