C56H29F6N7 — CID 155656599
2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile (PubChem CID 155656599) has the molecular formula C56H29F6N7 and a molecular weight of 913.88 g/mol. Its IUPAC name is 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile.
| Compound Name | 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile |
|---|---|
| PubChem CID | 155656599 |
| Molecular Formula | C56H29F6N7 |
| Molecular Weight | 913.88 g/mol |
| Exact Mass | 913.24 |
| IUPAC Name | 2-[9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3ccccc3C(F)(F)F)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ccccc2C(F)(F)F)c([N+]#[C-])c1 |
| InChI | InChI=1S/C56H29F6N7/c1-64-38-27-37(32-63)50(47(31-38)65-2)35-25-26-49-42(28-35)41-21-11-14-24-48(41)69(49)51-43(39-19-9-12-22-45(39)55(57,58)59)29-36(30-44(51)40-20-10-13-23-46(40)56(60,61)62)54-67-52(33-15-5-3-6-16-33)66-53(68-54)34-17-7-4-8-18-34/h3-31H |
| InChIKey | RDRJBRPGCLCKRA-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.88 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|