C57H30F6N6 — CID 155656805
2-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile (PubChem CID 155656805) has the molecular formula C57H30F6N6 and a molecular weight of 912.90 g/mol. Its IUPAC name is 2-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile.
| Compound Name | 2-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile |
|---|---|
| PubChem CID | 155656805 |
| Molecular Formula | C57H30F6N6 |
| Molecular Weight | 912.90 g/mol |
| Exact Mass | 912.24 |
| IUPAC Name | 2-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3,5-diisocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)c(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3ccccc3C(F)(F)F)cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ccccc2C(F)(F)F)c([N+]#[C-])c1 |
| InChI | InChI=1S/C57H30F6N6/c1-65-39-27-38(33-64)53(50(31-39)66-2)36-25-26-52-43(28-36)42-21-11-14-24-51(42)69(52)54-44(40-19-9-12-22-46(40)56(58,59)60)29-37(30-45(54)41-20-10-13-23-47(41)57(61,62)63)49-32-48(34-15-5-3-6-16-34)67-55(68-49)35-17-7-4-8-18-35/h3-32H |
| InChIKey | ULKHXAABQJPZBH-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.90 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|