C56H31F6N5 — CID 155656739
4-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3-isocyanobenzonitrile (PubChem CID 155656739) has the molecular formula C56H31F6N5 and a molecular weight of 887.89 g/mol. Its IUPAC name is 4-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3-isocyanobenzonitrile.
| Compound Name | 4-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 155656739 |
| Molecular Formula | C56H31F6N5 |
| Molecular Weight | 887.89 g/mol |
| Exact Mass | 887.25 |
| IUPAC Name | 4-[9-[4-(2,6-diphenylpyrimidin-4-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]carbazol-3-yl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)ccc1-c1ccc2c(c1)c1ccccc1n2-c1c(-c2ccccc2C(F)(F)F)cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C56H31F6N5/c1-64-50-28-34(33-63)24-26-39(50)37-25-27-52-43(29-37)42-20-10-13-23-51(42)67(52)53-44(40-18-8-11-21-46(40)55(57,58)59)30-38(31-45(53)41-19-9-12-22-47(41)56(60,61)62)49-32-48(35-14-4-2-5-15-35)65-54(66-49)36-16-6-3-7-17-36/h2-32H |
| InChIKey | BZZUKVATYOIJMN-UHFFFAOYSA-N |
| XLogP | 16.04 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.89 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|