C60H37F6N3 — CID 155447127
9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-diphenylcarbazole (PubChem CID 155447127) has the molecular formula C60H37F6N3 and a molecular weight of 913.97 g/mol. Its IUPAC name is 9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 155447127 |
| Molecular Formula | C60H37F6N3 |
| Molecular Weight | 913.97 g/mol |
| Exact Mass | 913.29 |
| IUPAC Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2,6-bis[2-(trifluoromethyl)phenyl]phenyl]-3,6-diphenylcarbazole |
| SMILES | FC(F)(F)c1ccccc1-c1cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc(-c2ccccc2C(F)(F)F)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C60H37F6N3/c61-59(62,63)51-27-15-13-25-45(51)49-35-44(58-67-53(40-21-9-3-10-22-40)37-54(68-58)41-23-11-4-12-24-41)36-50(46-26-14-16-28-52(46)60(64,65)66)57(49)69-55-31-29-42(38-17-5-1-6-18-38)33-47(55)48-34-43(30-32-56(48)69)39-19-7-2-8-20-39/h1-37H |
| InChIKey | JKLNRSNCESQEQR-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.97 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |