C58H39N3 — CID 146280804
9-[2,6-diphenyl-4-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-3-phenylcarbazole (PubChem CID 146280804) has the molecular formula C58H39N3 and a molecular weight of 777.97 g/mol. Its IUPAC name is 9-[2,6-diphenyl-4-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-3-phenylcarbazole.
| Compound Name | 9-[2,6-diphenyl-4-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-3-phenylcarbazole |
|---|---|
| PubChem CID | 146280804 |
| Molecular Formula | C58H39N3 |
| Molecular Weight | 777.97 g/mol |
| Exact Mass | 777.31 |
| IUPAC Name | 9-[2,6-diphenyl-4-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-3-phenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccccc4)nc(-c4cc(-c5ccccc5)c(-n5c6ccccc6c6cc(-c7ccccc7)ccc65)c(-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C58H39N3/c1-6-18-40(19-7-1)42-30-32-46(33-31-42)54-39-53(45-26-14-5-15-27-45)59-58(60-54)48-37-50(43-22-10-3-11-23-43)57(51(38-48)44-24-12-4-13-25-44)61-55-29-17-16-28-49(55)52-36-47(34-35-56(52)61)41-20-8-2-9-21-41/h1-39H |
| InChIKey | JMURLYGWLYZHHK-UHFFFAOYSA-N |
| XLogP | 15.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.97 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |