C49H32N6 — CID 146280577
9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-phenylcarbazole (PubChem CID 146280577) has the molecular formula C49H32N6 and a molecular weight of 704.84 g/mol. Its IUPAC name is 9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-phenylcarbazole.
| Compound Name | 9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-phenylcarbazole |
|---|---|
| PubChem CID | 146280577 |
| Molecular Formula | C49H32N6 |
| Molecular Weight | 704.84 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | 9-[4-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-3-phenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3ccccc3)cc(-c3nc(-c4ccncc4)nc(-c4ccncc4)n3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C49H32N6/c1-4-12-33(13-5-1)38-20-21-45-43(30-38)40-18-10-11-19-44(40)55(45)46-41(34-14-6-2-7-15-34)31-39(32-42(46)35-16-8-3-9-17-35)49-53-47(36-22-26-50-27-23-36)52-48(54-49)37-24-28-51-29-25-37/h1-32H |
| InChIKey | GEVIOAUDLCGPFV-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.84 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |